C16H13F2N3OS2 — CID 55907163
N-[4-(dimethylamino)-3,5-difluorophenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 55907163) has the molecular formula C16H13F2N3OS2 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3,5-difluorophenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55907163 |
| Molecular Formula | C16H13F2N3OS2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1c(F)cc(NC(=O)c2csc(-c3cccs3)n2)cc1F |
| InChI | InChI=1S/C16H13F2N3OS2/c1-21(2)14-10(17)6-9(7-11(14)18)19-15(22)12-8-24-16(20-12)13-4-3-5-23-13/h3-8H,1-2H3,(H,19,22) |
| InChIKey | NQMGPCXQDRFUSV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|