C15H16N4O4 — CID 36566494
methyl 5-nitro-2-[2-(pyridin-2-ylamino)ethylamino]benzoate (PubChem CID 36566494) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is methyl 5-nitro-2-[2-(pyridin-2-ylamino)ethylamino]benzoate.
| Compound Name | methyl 5-nitro-2-[2-(pyridin-2-ylamino)ethylamino]benzoate |
|---|---|
| PubChem CID | 36566494 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 5-nitro-2-[2-(pyridin-2-ylamino)ethylamino]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1NCCNc1ccccn1 |
| InChI | InChI=1S/C15H16N4O4/c1-23-15(20)12-10-11(19(21)22)5-6-13(12)16-8-9-18-14-4-2-3-7-17-14/h2-7,10,16H,8-9H2,1H3,(H,17,18) |
| InChIKey | IQCKKFDMUKYRJF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|