C16H17F3N4O5 — CID 55699873
methyl 5-nitro-2-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]amino]benzoate (PubChem CID 55699873) has the molecular formula C16H17F3N4O5 and a molecular weight of 402.33 g/mol. Its IUPAC name is methyl 5-nitro-2-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]amino]benzoate.
| Compound Name | methyl 5-nitro-2-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]amino]benzoate |
|---|---|
| PubChem CID | 55699873 |
| Molecular Formula | C16H17F3N4O5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 5-nitro-2-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]amino]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1NCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O5/c1-22-8-7-21-14(22)15(25,16(17,18)19)5-6-20-12-4-3-10(23(26)27)9-11(12)13(24)28-2/h3-4,7-9,20,25H,5-6H2,1-2H3 |
| InChIKey | LNLLUONKBXXBPE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|