C17H17F3N4O4 — CID 47789161
(E)-3-(3-nitrophenyl)-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]prop-2-enamide (PubChem CID 47789161) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(3-nitrophenyl)-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 47789161 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]prop-2-enamide |
| SMILES | Cn1ccnc1C(O)(CCNC(=O)/C=C/c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N4O4/c1-23-10-9-22-15(23)16(26,17(18,19)20)7-8-21-14(25)6-5-12-3-2-4-13(11-12)24(27)28/h2-6,9-11,26H,7-8H2,1H3,(H,21,25)/b6-5+ |
| InChIKey | OJWNZNQRHOJXJX-AATRIKPKSA-N |
| XLogP | 2.30 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|