C14H18F3N3O3 — CID 111466412
1,1,1-trifluoro-4-[[5-(hydroxymethyl)furan-2-yl]methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol (PubChem CID 111466412) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[[5-(hydroxymethyl)furan-2-yl]methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-[[5-(hydroxymethyl)furan-2-yl]methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 111466412 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1,1,1-trifluoro-4-[[5-(hydroxymethyl)furan-2-yl]methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol |
| SMILES | Cn1ccnc1C(O)(CCNCc1ccc(CO)o1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O3/c1-20-7-6-19-12(20)13(22,14(15,16)17)4-5-18-8-10-2-3-11(9-21)23-10/h2-3,6-7,18,21-22H,4-5,8-9H2,1H3 |
| InChIKey | HXRLBCCLCOTDPI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|