C16H24F3N3O2 — CID 111470134
3,4,4-trimethyl-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pent-2-enamide (PubChem CID 111470134) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3,4,4-trimethyl-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pent-2-enamide.
| Compound Name | 3,4,4-trimethyl-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pent-2-enamide |
|---|---|
| PubChem CID | 111470134 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3,4,4-trimethyl-N-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pent-2-enamide |
| SMILES | CC(=CC(=O)NCCC(O)(c1nccn1C)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C16H24F3N3O2/c1-11(14(2,3)4)10-12(23)20-7-6-15(24,16(17,18)19)13-21-8-9-22(13)5/h8-10,24H,6-7H2,1-5H3,(H,20,23) |
| InChIKey | ZQMXAYSXTMMHGK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|