C15H24F3N3O2 — CID 111439436
N-(4,4-dimethylpentyl)-4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanamide (PubChem CID 111439436) has the molecular formula C15H24F3N3O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanamide.
| Compound Name | N-(4,4-dimethylpentyl)-4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 111439436 |
| Molecular Formula | C15H24F3N3O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-(4,4-dimethylpentyl)-4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanamide |
| SMILES | Cn1ccnc1C(O)(CC(=O)NCCCC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H24F3N3O2/c1-13(2,3)6-5-7-19-11(22)10-14(23,15(16,17)18)12-20-8-9-21(12)4/h8-9,23H,5-7,10H2,1-4H3,(H,19,22) |
| InChIKey | JUSCVFFPBLCTPC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|