C9H9F5N2O3 — CID 96839916
(3R)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1-methylimidazol-2-yl)pentanoic acid (PubChem CID 96839916) has the molecular formula C9H9F5N2O3 and a molecular weight of 288.17 g/mol. Its IUPAC name is (3R)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1-methylimidazol-2-yl)pentanoic acid.
| Compound Name | (3R)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1-methylimidazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 96839916 |
| Molecular Formula | C9H9F5N2O3 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (3R)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1-methylimidazol-2-yl)pentanoic acid |
| SMILES | Cn1ccnc1[C@](O)(CC(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5N2O3/c1-16-3-2-15-6(16)7(19,4-5(17)18)8(10,11)9(12,13)14/h2-3,19H,4H2,1H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | LYLHVGATUWGQOD-SSDOTTSWSA-N |
| XLogP | 1.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|