C23H27N3O8 — CID 175433014
methyl 2-[[6-methoxy-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-5-nitrobenzoate (PubChem CID 175433014) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is methyl 2-[[6-methoxy-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-5-nitrobenzoate.
| Compound Name | methyl 2-[[6-methoxy-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 175433014 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl 2-[[6-methoxy-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1NCCCCC(NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C23H27N3O8/c1-32-21(27)18-14-17(26(30)31)11-12-19(18)24-13-7-6-10-20(22(28)33-2)25-23(29)34-15-16-8-4-3-5-9-16/h3-5,8-9,11-12,14,20,24H,6-7,10,13,15H2,1-2H3,(H,25,29) |
| InChIKey | VKMZCYGEWLHQOK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|