C17H21FN6O2 — CID 134003448
4-fluoro-2-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]aniline (PubChem CID 134003448) has the molecular formula C17H21FN6O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]aniline.
| Compound Name | 4-fluoro-2-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]aniline |
|---|---|
| PubChem CID | 134003448 |
| Molecular Formula | C17H21FN6O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-fluoro-2-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]aniline |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H21FN6O2/c18-14-3-4-15(16(13-14)24(25)26)19-7-2-8-22-9-11-23(12-10-22)17-20-5-1-6-21-17/h1,3-6,13,19H,2,7-12H2 |
| InChIKey | CCFTUMDQYGKZFS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|