C17H19F4N5O2S — CID 133283635
4-fluoro-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline (PubChem CID 133283635) has the molecular formula C17H19F4N5O2S and a molecular weight of 433.43 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133283635 |
| Molecular Formula | C17H19F4N5O2S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-fluoro-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1cc(F)ccc1NCCN1CCN(c2ncccn2)CC1)C(F)(F)F |
| InChI | InChI=1S/C17H19F4N5O2S/c18-13-2-3-14(15(12-13)29(27,28)17(19,20)21)22-6-7-25-8-10-26(11-9-25)16-23-4-1-5-24-16/h1-5,12,22H,6-11H2 |
| InChIKey | PLQBDIDYDYDMLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |