C13H6ClF3N4O6 — CID 22769708
N-(2-chloro-5-nitrophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline (PubChem CID 22769708) has the molecular formula C13H6ClF3N4O6 and a molecular weight of 406.66 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 22769708 |
| Molecular Formula | C13H6ClF3N4O6 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6ClF3N4O6/c14-9-2-1-6(19(22)23)4-10(9)18-12-8(13(15,16)17)3-7(20(24)25)5-11(12)21(26)27/h1-5,18H |
| InChIKey | HNNSFLRVDQLFKI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|