C12H4Cl2F5N3O2 — CID 20538588
3,5-dichloro-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 20538588) has the molecular formula C12H4Cl2F5N3O2 and a molecular weight of 388.08 g/mol. Its IUPAC name is 3,5-dichloro-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | 3,5-dichloro-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 20538588 |
| Molecular Formula | C12H4Cl2F5N3O2 |
| Molecular Weight | 388.08 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3,5-dichloro-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2c(Cl)c(F)nc(F)c2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H4Cl2F5N3O2/c13-7-9(8(14)11(16)21-10(7)15)20-6-2-1-4(22(23)24)3-5(6)12(17,18)19/h1-3H,(H,20,21) |
| InChIKey | NJLMYRISUGEEKR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|