C8H3F6N3O6S — CID 59046680
N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 59046680) has the molecular formula C8H3F6N3O6S and a molecular weight of 383.18 g/mol. Its IUPAC name is N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 59046680 |
| Molecular Formula | C8H3F6N3O6S |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NS(=O)(=O)C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H3F6N3O6S/c9-7(10,11)4-1-3(16(18)19)2-5(17(20)21)6(4)15-24(22,23)8(12,13)14/h1-2,15H |
| InChIKey | BWLSGIZNWWFDBH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|