C6H5N5O7 — CID 174855795
N-(2,4,6-trinitroanilino)hydroxylamine (PubChem CID 174855795) has the molecular formula C6H5N5O7 and a molecular weight of 259.13 g/mol. Its IUPAC name is N-(2,4,6-trinitroanilino)hydroxylamine.
| Compound Name | N-(2,4,6-trinitroanilino)hydroxylamine |
|---|---|
| PubChem CID | 174855795 |
| Molecular Formula | C6H5N5O7 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-(2,4,6-trinitroanilino)hydroxylamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NNO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H5N5O7/c12-8-7-6-4(10(15)16)1-3(9(13)14)2-5(6)11(17)18/h1-2,7-8,12H |
| InChIKey | OAMNHMHDZCNMLP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 173.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|