C6H2N4O7 — CID 12734724
1,3,5-trinitro-2-nitrosobenzene (PubChem CID 12734724) has the molecular formula C6H2N4O7 and a molecular weight of 242.10 g/mol. Its IUPAC name is 1,3,5-trinitro-2-nitrosobenzene.
| Compound Name | 1,3,5-trinitro-2-nitrosobenzene |
|---|---|
| PubChem CID | 12734724 |
| Molecular Formula | C6H2N4O7 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1,3,5-trinitro-2-nitrosobenzene |
| SMILES | O=Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N4O7/c11-7-6-4(9(14)15)1-3(8(12)13)2-5(6)10(16)17/h1-2H |
| InChIKey | QBIFRSOGONPRRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 158.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|