C13H7N5O8 — CID 15466499
N-(4-nitrophenyl)-1-(2,4,6-trinitrophenyl)methanimine (PubChem CID 15466499) has the molecular formula C13H7N5O8 and a molecular weight of 361.23 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1-(2,4,6-trinitrophenyl)methanimine.
| Compound Name | N-(4-nitrophenyl)-1-(2,4,6-trinitrophenyl)methanimine |
|---|---|
| PubChem CID | 15466499 |
| Molecular Formula | C13H7N5O8 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(4-nitrophenyl)-1-(2,4,6-trinitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(/N=C/c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H7N5O8/c19-15(20)9-3-1-8(2-4-9)14-7-11-12(17(23)24)5-10(16(21)22)6-13(11)18(25)26/h1-7H/b14-7+ |
| InChIKey | DCADCSUMDKFWJZ-VGOFMYFVSA-N |
| XLogP | 3.07 |
| TPSA | 184.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|