C19H21N3O5 — CID 136823627
2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-3,5-dinitrophenol (PubChem CID 136823627) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-3,5-dinitrophenol.
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-3,5-dinitrophenol |
|---|---|
| PubChem CID | 136823627 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-3,5-dinitrophenol |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N3O5/c1-11(2)14-6-5-7-15(12(3)4)19(14)20-10-16-17(22(26)27)8-13(21(24)25)9-18(16)23/h5-12,23H,1-4H3/b20-10+ |
| InChIKey | NHBOYUZIRMQDJN-KEBDBYFISA-N |
| XLogP | 5.21 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|