C25H29N3O2 — CID 58722009
2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N,8-dimethyl-4-nitronaphthalen-1-amine (PubChem CID 58722009) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N,8-dimethyl-4-nitronaphthalen-1-amine.
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N,8-dimethyl-4-nitronaphthalen-1-amine |
|---|---|
| PubChem CID | 58722009 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N,8-dimethyl-4-nitronaphthalen-1-amine |
| SMILES | CNc1c(/C=N/c2c(C(C)C)cccc2C(C)C)cc([N+](=O)[O-])c2cccc(C)c12 |
| InChI | InChI=1S/C25H29N3O2/c1-15(2)19-10-8-11-20(16(3)4)25(19)27-14-18-13-22(28(29)30)21-12-7-9-17(5)23(21)24(18)26-6/h7-16,26H,1-6H3/b27-14+ |
| InChIKey | BLTGUWCDISLVNX-MZJWZYIUSA-N |
| XLogP | 7.10 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|