C24H33NO — CID 160938473
4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methylphenol (PubChem CID 160938473) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 160938473 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 4-tert-butyl-2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-6-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)cc(/C=N/c2c(C(C)C)cccc2C(C)C)c1O |
| InChI | InChI=1S/C24H33NO/c1-15(2)20-10-9-11-21(16(3)4)22(20)25-14-18-13-19(24(6,7)8)12-17(5)23(18)26/h9-16,26H,1-8H3/b25-14+ |
| InChIKey | SJBZASZBIWHHOK-AFUMVMLFSA-N |
| XLogP | 7.00 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|