C24H32FNO — CID 137282686
2-[(2,6-ditert-butylphenyl)iminomethyl]-4-fluoro-6-propan-2-ylphenol (PubChem CID 137282686) has the molecular formula C24H32FNO and a molecular weight of 369.52 g/mol. Its IUPAC name is 2-[(2,6-ditert-butylphenyl)iminomethyl]-4-fluoro-6-propan-2-ylphenol.
| Compound Name | 2-[(2,6-ditert-butylphenyl)iminomethyl]-4-fluoro-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 137282686 |
| Molecular Formula | C24H32FNO |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-[(2,6-ditert-butylphenyl)iminomethyl]-4-fluoro-6-propan-2-ylphenol |
| SMILES | CC(C)c1cc(F)cc(/C=N/c2c(C(C)(C)C)cccc2C(C)(C)C)c1O |
| InChI | InChI=1S/C24H32FNO/c1-15(2)18-13-17(25)12-16(22(18)27)14-26-21-19(23(3,4)5)10-9-11-20(21)24(6,7)8/h9-15,27H,1-8H3/b26-14+ |
| InChIKey | YFMIYIFVXOJETB-VULFUBBASA-N |
| XLogP | 7.00 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|