C50H50Cl2F4N2O2Ti — CID 166175408
bis(2-[1-(4-tert-butylphenyl)ethyl]-6-[(2,6-difluorophenyl)iminomethyl]phenol);dichlorotitanium (PubChem CID 166175408) has the molecular formula C50H50Cl2F4N2O2Ti and a molecular weight of 905.73 g/mol. Its IUPAC name is bis(2-[1-(4-tert-butylphenyl)ethyl]-6-[(2,6-difluorophenyl)iminomethyl]phenol);dichlorotitanium.
| Compound Name | bis(2-[1-(4-tert-butylphenyl)ethyl]-6-[(2,6-difluorophenyl)iminomethyl]phenol);dichlorotitanium |
|---|---|
| PubChem CID | 166175408 |
| Molecular Formula | C50H50Cl2F4N2O2Ti |
| Molecular Weight | 905.73 g/mol |
| Exact Mass | 904.27 |
| IUPAC Name | bis(2-[1-(4-tert-butylphenyl)ethyl]-6-[(2,6-difluorophenyl)iminomethyl]phenol);dichlorotitanium |
| SMILES | CC(c1ccc(C(C)(C)C)cc1)c1cccc(/C=N/c2c(F)cccc2F)c1O.CC(c1ccc(C(C)(C)C)cc1)c1cccc(C=Nc2c(F)cccc2F)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/2C25H25F2NO.2ClH.Ti/c2*1-16(17-11-13-19(14-12-17)25(2,3)4)20-8-5-7-18(24(20)29)15-28-23-21(26)9-6-10-22(23)27;;;/h2*5-16,29H,1-4H3;2*1H;/q;;;;+2/p-2/b28-15+;;;; |
| InChIKey | HPLHMKFFJAOEGV-QIEDWMIKSA-L |
| XLogP | 15.12 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.73 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|