C17H16F3NO — CID 136928876
4-tert-butyl-2-[(2,4,6-trifluorophenyl)iminomethyl]phenol (PubChem CID 136928876) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is 4-tert-butyl-2-[(2,4,6-trifluorophenyl)iminomethyl]phenol.
| Compound Name | 4-tert-butyl-2-[(2,4,6-trifluorophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136928876 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-tert-butyl-2-[(2,4,6-trifluorophenyl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(/C=N/c2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C17H16F3NO/c1-17(2,3)11-4-5-15(22)10(6-11)9-21-16-13(19)7-12(18)8-14(16)20/h4-9,22H,1-3H3/b21-9+ |
| InChIKey | LFEPFWKHZOWARB-ZVBGSRNCSA-N |
| XLogP | 4.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|