C25H27NO2 — CID 135512991
4-tert-butyl-2-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol (PubChem CID 135512991) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol.
| Compound Name | 4-tert-butyl-2-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135512991 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-tert-butyl-2-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(/C=N/[C@@H](c2ccccc2)[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27NO2/c1-25(2,3)21-14-15-22(27)20(16-21)17-26-23(18-10-6-4-7-11-18)24(28)19-12-8-5-9-13-19/h4-17,23-24,27-28H,1-3H3/b26-17+/t23-,24+/m0/s1 |
| InChIKey | WEWTXAJHOLGCPU-DMBFUDIBSA-N |
| XLogP | 5.58 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|