C30H28N2O2 — CID 136866110
2-[[(1S,2S)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-methylphenol (PubChem CID 136866110) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-methylphenol.
| Compound Name | 2-[[(1S,2S)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 136866110 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[[(1S,2S)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/C=N/[C@@H](c2ccccc2)[C@@H](/N=C/c2cc(C)ccc2O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H28N2O2/c1-21-13-15-27(33)25(17-21)19-31-29(23-9-5-3-6-10-23)30(24-11-7-4-8-12-24)32-20-26-18-22(2)14-16-28(26)34/h3-20,29-30,33-34H,1-2H3/b31-19+,32-20+/t29-,30-/m0/s1 |
| InChIKey | JOTKLGKMGZNEHJ-ITVZCETASA-N |
| XLogP | 6.74 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|