C17H19NO2 — CID 136861223
2-[(1-hydroxy-1-phenylpropan-2-yl)iminomethyl]-4-methylphenol (PubChem CID 136861223) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[(1-hydroxy-1-phenylpropan-2-yl)iminomethyl]-4-methylphenol.
| Compound Name | 2-[(1-hydroxy-1-phenylpropan-2-yl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 136861223 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[(1-hydroxy-1-phenylpropan-2-yl)iminomethyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/C=N/C(C)C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H19NO2/c1-12-8-9-16(19)15(10-12)11-18-13(2)17(20)14-6-4-3-5-7-14/h3-11,13,17,19-20H,1-2H3/b18-11+ |
| InChIKey | DDHAJBNRUBZHDQ-WOJGMQOQSA-N |
| XLogP | 3.24 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|