About CID 46222276
CID 46222276 (PubChem CID 46222276) has the molecular formula C20H21FeNO+2
and a molecular weight of 347.24 g/mol.
Molecular Properties
| Compound Name | CID 46222276 |
| PubChem CID | 46222276 |
| Molecular Formula | C20H21FeNO+2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | — |
| SMILES | C[C@H](/N=C/[C]1[CH][CH][CH][CH]1)[C@H](O)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H16NO.C5H5.Fe/c1-12(16-11-13-7-5-6-8-13)15(17)14-9-3-2-4-10-14;1-2-4-5-3-1;/h2-12,15,17H,1H3;1-5H;/q;;+2/b16-11+;;/t12-,15-;;/m0../s1 |
| InChIKey | MYWDUBRSAKKBAC-WUWVVCEXSA-N |
| XLogP | 3.60 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 46222276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46222276?
The IUPAC name of CID 46222276 (CID 46222276) is not available.
What is the SMILES notation for CID 46222276?
The canonical SMILES for CID 46222276 is C[C@H](/N=C/[C]1[CH][CH][CH][CH]1)[C@H](O)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 46222276?
The InChIKey is MYWDUBRSAKKBAC-WUWVVCEXSA-N. The full InChI is InChI=1S/C15H16NO.C5H5.Fe/c1-12(16-11-13-7-5-6-8-13)15(17)14-9-3-2-4-10-14;1-2-4-5-3-1;/h2-12,15,17H,1H3;1-5H;/q;;+2/b16-11+;;/t12-,15-;;/m0../s1.
What are the key properties of CID 46222276?
CID 46222276 has a molecular weight of 347.24 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46222276 is sourced from PubChem (CID 46222276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).