C11H18NO+ — CID 7059595
[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium (PubChem CID 7059595) has the molecular formula C11H18NO+ and a molecular weight of 180.27 g/mol. Its IUPAC name is [(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium.
| Compound Name | [(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 7059595 |
| Molecular Formula | C11H18NO+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | [(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)[NH+](C)C |
| InChI | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3/p+1/t9-,11+/m0/s1 |
| InChIKey | FMCGSUUBYTWNDP-GXSJLCMTSA-O |
| XLogP | 0.25 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |