C19H25NO3 — CID 139144469
[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium;2-methylbenzoate (PubChem CID 139144469) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium;2-methylbenzoate.
| Compound Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium;2-methylbenzoate |
|---|---|
| PubChem CID | 139144469 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-dimethylazanium;2-methylbenzoate |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)[NH+](C)C.Cc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C11H17NO.C8H8O2/c1-9(12(2)3)11(13)10-7-5-4-6-8-10;1-6-4-2-3-5-7(6)8(9)10/h4-9,11,13H,1-3H3;2-5H,1H3,(H,9,10)/t9-,11-;/m0./s1 |
| InChIKey | CNRQTGFNHCJWJQ-ROLPUNSJSA-N |
| XLogP | 0.61 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |