About 1-(2-methylphenyl)ethanone;propan-2-ol;titanium
1-(2-methylphenyl)ethanone;propan-2-ol;titanium (PubChem CID 59928874) has the molecular formula C12H17O2Ti-
and a molecular weight of 241.13 g/mol. Its IUPAC name is 1-(2-methylphenyl)ethanone;propan-2-ol;titanium.
Molecular Properties
| Compound Name | 1-(2-methylphenyl)ethanone;propan-2-ol;titanium |
| PubChem CID | 59928874 |
| Molecular Formula | C12H17O2Ti- |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(2-methylphenyl)ethanone;propan-2-ol;titanium |
| SMILES | CC(C)O.[CH2-]C(=O)c1ccccc1C.[Ti] |
| InChI | InChI=1S/C9H9O.C3H8O.Ti/c1-7-5-3-4-6-9(7)8(2)10;1-3(2)4;/h3-6H,2H2,1H3;3-4H,1-2H3;/q-1;; |
| InChIKey | QSXBSFHBWNIYLU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylphenyl)ethanone;propan-2-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylphenyl)ethanone;propan-2-ol;titanium?
The IUPAC name of 1-(2-methylphenyl)ethanone;propan-2-ol;titanium (CID 59928874) is 1-(2-methylphenyl)ethanone;propan-2-ol;titanium.
What is the SMILES notation for 1-(2-methylphenyl)ethanone;propan-2-ol;titanium?
The canonical SMILES for 1-(2-methylphenyl)ethanone;propan-2-ol;titanium is CC(C)O.[CH2-]C(=O)c1ccccc1C.[Ti].
What is the InChIKey of 1-(2-methylphenyl)ethanone;propan-2-ol;titanium?
The InChIKey is QSXBSFHBWNIYLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O.C3H8O.Ti/c1-7-5-3-4-6-9(7)8(2)10;1-3(2)4;/h3-6H,2H2,1H3;3-4H,1-2H3;/q-1;;.
What are the key properties of 1-(2-methylphenyl)ethanone;propan-2-ol;titanium?
1-(2-methylphenyl)ethanone;propan-2-ol;titanium has a molecular weight of 241.13 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylphenyl)ethanone;propan-2-ol;titanium is sourced from PubChem (CID 59928874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).