C11H18NO2+ — CID 173093688
[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-dimethylazanium (PubChem CID 173093688) has the molecular formula C11H18NO2+ and a molecular weight of 196.27 g/mol. Its IUPAC name is [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-dimethylazanium.
| Compound Name | [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 173093688 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CO)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H17NO2/c1-12(2)10(8-13)11(14)9-6-4-3-5-7-9/h3-7,10-11,13-14H,8H2,1-2H3/p+1/t10-,11-/m1/s1 |
| InChIKey | UMSLXKMPZZNDCQ-GHMZBOCLSA-O |
| XLogP | -0.77 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |