C11H17NO2 — CID 67123250
(2R)-2-(methylaminomethyl)-1-phenylpropane-1,3-diol (PubChem CID 67123250) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2R)-2-(methylaminomethyl)-1-phenylpropane-1,3-diol.
| Compound Name | (2R)-2-(methylaminomethyl)-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 67123250 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2R)-2-(methylaminomethyl)-1-phenylpropane-1,3-diol |
| SMILES | CNC[C@H](CO)C(O)c1ccccc1 |
| InChI | InChI=1S/C11H17NO2/c1-12-7-10(8-13)11(14)9-5-3-2-4-6-9/h2-6,10-14H,7-8H2,1H3/t10-,11?/m1/s1 |
| InChIKey | VCAJSTXKUHNFQE-NFJWQWPMSA-N |
| XLogP | 0.55 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |