C10H14O4S — CID 102550536
2-methylsulfonyl-1-phenylpropane-1,3-diol (PubChem CID 102550536) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-methylsulfonyl-1-phenylpropane-1,3-diol.
| Compound Name | 2-methylsulfonyl-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 102550536 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-methylsulfonyl-1-phenylpropane-1,3-diol |
| SMILES | CS(=O)(=O)C(CO)C(O)c1ccccc1 |
| InChI | InChI=1S/C10H14O4S/c1-15(13,14)9(7-11)10(12)8-5-3-2-4-6-8/h2-6,9-12H,7H2,1H3 |
| InChIKey | WRLVHLOQGXHYGF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |