About CID 11290967
CID 11290967 (PubChem CID 11290967) has the molecular formula C20H21FeNO+2
and a molecular weight of 347.24 g/mol.
Molecular Properties
| Compound Name | CID 11290967 |
| PubChem CID | 11290967 |
| Molecular Formula | C20H21FeNO+2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | — |
| SMILES | COC[C@@H](/N=C/[C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H16NO.C5H5.Fe/c1-17-12-15(14-9-3-2-4-10-14)16-11-13-7-5-6-8-13;1-2-4-5-3-1;/h2-11,15H,12H2,1H3;1-5H;/q;;+2/b16-11+;;/t15-;;/m1../s1 |
| InChIKey | SAVKHMVCQINQAX-SEHYVDFYSA-N |
| XLogP | 3.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11290967 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11290967?
The IUPAC name of CID 11290967 (CID 11290967) is not available.
What is the SMILES notation for CID 11290967?
The canonical SMILES for CID 11290967 is COC[C@@H](/N=C/[C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11290967?
The InChIKey is SAVKHMVCQINQAX-SEHYVDFYSA-N. The full InChI is InChI=1S/C15H16NO.C5H5.Fe/c1-17-12-15(14-9-3-2-4-10-14)16-11-13-7-5-6-8-13;1-2-4-5-3-1;/h2-11,15H,12H2,1H3;1-5H;/q;;+2/b16-11+;;/t15-;;/m1../s1.
What are the key properties of CID 11290967?
CID 11290967 has a molecular weight of 347.24 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11290967 is sourced from PubChem (CID 11290967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).