C28H24N2O4 — CID 135431645
2-[[(1R,2S)-1,2-bis(3-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol (PubChem CID 135431645) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[(1R,2S)-1,2-bis(3-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol.
| Compound Name | 2-[[(1R,2S)-1,2-bis(3-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135431645 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[(1R,2S)-1,2-bis(3-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
| SMILES | Oc1cccc([C@@H](/N=C/c2ccccc2O)[C@@H](/N=C/c2ccccc2O)c2cccc(O)c2)c1 |
| InChI | InChI=1S/C28H24N2O4/c31-23-11-5-9-19(15-23)27(29-17-21-7-1-3-13-25(21)33)28(20-10-6-12-24(32)16-20)30-18-22-8-2-4-14-26(22)34/h1-18,27-28,31-34H/b29-17+,30-18+/t27-,28+ |
| InChIKey | OXYGSVSCEXWICK-JUDLYGPSSA-N |
| XLogP | 5.53 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|