C28H24CoN2O4 — CID 135514483
2-[[(1S,2R)-1,2-bis(4-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol;cobalt (PubChem CID 135514483) has the molecular formula C28H24CoN2O4 and a molecular weight of 511.44 g/mol. Its IUPAC name is 2-[[(1S,2R)-1,2-bis(4-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol;cobalt.
| Compound Name | 2-[[(1S,2R)-1,2-bis(4-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol;cobalt |
|---|---|
| PubChem CID | 135514483 |
| Molecular Formula | C28H24CoN2O4 |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 2-[[(1S,2R)-1,2-bis(4-hydroxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol;cobalt |
| SMILES | Oc1ccc([C@@H](/N=C/c2ccccc2O)[C@@H](/N=C/c2ccccc2O)c2ccc(O)cc2)cc1.[Co] |
| InChI | InChI=1S/C28H24N2O4.Co/c31-23-13-9-19(10-14-23)27(29-17-21-5-1-3-7-25(21)33)28(20-11-15-24(32)16-12-20)30-18-22-6-2-4-8-26(22)34;/h1-18,27-28,31-34H;/b29-17+,30-18+;/t27-,28+; |
| InChIKey | WJRJWPNOVZIHII-KTNDRTGNSA-N |
| XLogP | 5.53 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|