C30H28CoN2O4 — CID 135440453
cobalt;2-[[(1S,2R)-2-[(2-hydroxyphenyl)methylideneamino]-1,2-bis(2-methoxyphenyl)ethyl]iminomethyl]phenol (PubChem CID 135440453) has the molecular formula C30H28CoN2O4 and a molecular weight of 539.50 g/mol. Its IUPAC name is cobalt;2-[[(1S,2R)-2-[(2-hydroxyphenyl)methylideneamino]-1,2-bis(2-methoxyphenyl)ethyl]iminomethyl]phenol.
| Compound Name | cobalt;2-[[(1S,2R)-2-[(2-hydroxyphenyl)methylideneamino]-1,2-bis(2-methoxyphenyl)ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135440453 |
| Molecular Formula | C30H28CoN2O4 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | cobalt;2-[[(1S,2R)-2-[(2-hydroxyphenyl)methylideneamino]-1,2-bis(2-methoxyphenyl)ethyl]iminomethyl]phenol |
| SMILES | COc1ccccc1[C@@H](/N=C/c1ccccc1O)[C@@H](/N=C/c1ccccc1O)c1ccccc1OC.[Co] |
| InChI | InChI=1S/C30H28N2O4.Co/c1-35-27-17-9-5-13-23(27)29(31-19-21-11-3-7-15-25(21)33)30(24-14-6-10-18-28(24)36-2)32-20-22-12-4-8-16-26(22)34;/h3-20,29-30,33-34H,1-2H3;/b31-19+,32-20+;/t29-,30+; |
| InChIKey | PBHKJMZZEZLHFP-SZJUQYFLSA-N |
| XLogP | 6.13 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|