C30H24Cl2F2N2O4 — CID 135507370
2-[[(1R,2S)-1,2-bis(6-chloro-2-fluoro-3-methoxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol (PubChem CID 135507370) has the molecular formula C30H24Cl2F2N2O4 and a molecular weight of 585.43 g/mol. Its IUPAC name is 2-[[(1R,2S)-1,2-bis(6-chloro-2-fluoro-3-methoxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol.
| Compound Name | 2-[[(1R,2S)-1,2-bis(6-chloro-2-fluoro-3-methoxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135507370 |
| Molecular Formula | C30H24Cl2F2N2O4 |
| Molecular Weight | 585.43 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 2-[[(1R,2S)-1,2-bis(6-chloro-2-fluoro-3-methoxyphenyl)-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
| SMILES | COc1ccc(Cl)c([C@@H](/N=C/c2ccccc2O)[C@@H](/N=C/c2ccccc2O)c2c(Cl)ccc(OC)c2F)c1F |
| InChI | InChI=1S/C30H24Cl2F2N2O4/c1-39-23-13-11-19(31)25(27(23)33)29(35-15-17-7-3-5-9-21(17)37)30(36-16-18-8-4-6-10-22(18)38)26-20(32)12-14-24(40-2)28(26)34/h3-16,29-30,37-38H,1-2H3/b35-15+,36-16+/t29-,30+ |
| InChIKey | PJZOHDRJCNXJAJ-GAYMMJCRSA-N |
| XLogP | 7.72 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.43 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|