C34H36N2O4 — CID 70347590
2-[(1R,2S)-2-(2-hydroxyphenyl)-1,2-bis[(4-methoxy-2,6-dimethylphenyl)methylideneamino]ethyl]phenol (PubChem CID 70347590) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(2-hydroxyphenyl)-1,2-bis[(4-methoxy-2,6-dimethylphenyl)methylideneamino]ethyl]phenol.
| Compound Name | 2-[(1R,2S)-2-(2-hydroxyphenyl)-1,2-bis[(4-methoxy-2,6-dimethylphenyl)methylideneamino]ethyl]phenol |
|---|---|
| PubChem CID | 70347590 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[(1R,2S)-2-(2-hydroxyphenyl)-1,2-bis[(4-methoxy-2,6-dimethylphenyl)methylideneamino]ethyl]phenol |
| SMILES | COc1cc(C)c(/C=N/[C@H](c2ccccc2O)[C@@H](/N=C/c2c(C)cc(OC)cc2C)c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C34H36N2O4/c1-21-15-25(39-5)16-22(2)29(21)19-35-33(27-11-7-9-13-31(27)37)34(28-12-8-10-14-32(28)38)36-20-30-23(3)17-26(40-6)18-24(30)4/h7-20,33-34,37-38H,1-6H3/b35-19+,36-20+/t33-,34+ |
| InChIKey | ZZYRBEBGOZHGCU-GQMWGCRUSA-N |
| XLogP | 7.37 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|