C23H22O4 — CID 123691601
2-[[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-hydroxymethyl]phenol (PubChem CID 123691601) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-hydroxymethyl]phenol.
| Compound Name | 2-[[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-hydroxymethyl]phenol |
|---|---|
| PubChem CID | 123691601 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-hydroxymethyl]phenol |
| SMILES | COc1cc(C=Cc2ccc(C(O)c3ccccc3O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C23H22O4/c1-26-19-13-17(14-20(15-19)27-2)8-7-16-9-11-18(12-10-16)23(25)21-5-3-4-6-22(21)24/h3-15,23-25H,1-2H3 |
| InChIKey | ULMHXGFEOVQDTL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|