C36H40O8 — CID 139077239
1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene (PubChem CID 139077239) has the molecular formula C36H40O8 and a molecular weight of 600.71 g/mol. Its IUPAC name is 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 139077239 |
| Molecular Formula | C36H40O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1.COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/2C18H20O4/c2*1-19-15-7-13(8-16(11-15)20-2)5-6-14-9-17(21-3)12-18(10-14)22-4/h2*5-12H,1-4H3/b2*6-5+ |
| InChIKey | YVSXLJJKDVATRX-HBVWGTQWSA-N |
| XLogP | 7.78 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|