About 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene
1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene (PubChem CID 139077239) has the molecular formula C36H40O8
and a molecular weight of 600.71 g/mol. Its IUPAC name is 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
| PubChem CID | 139077239 |
| Molecular Formula | C36H40O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1.COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/2C18H20O4/c2*1-19-15-7-13(8-16(11-15)20-2)5-6-14-9-17(21-3)12-18(10-14)22-4/h2*5-12H,1-4H3/b2*6-5+ |
| InChIKey | YVSXLJJKDVATRX-HBVWGTQWSA-N |
| XLogP | 7.78 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene?
The IUPAC name of 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene (CID 139077239) is 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene.
What is the SMILES notation for 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene?
The canonical SMILES for 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene is COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1.COc1cc(/C=C/c2cc(OC)cc(OC)c2)cc(OC)c1.
What is the InChIKey of 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene?
The InChIKey is YVSXLJJKDVATRX-HBVWGTQWSA-N. The full InChI is InChI=1S/2C18H20O4/c2*1-19-15-7-13(8-16(11-15)20-2)5-6-14-9-17(21-3)12-18(10-14)22-4/h2*5-12H,1-4H3/b2*6-5+.
What are the key properties of 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene?
1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene has a molecular weight of 600.71 g/mol, XLogP of 7.78, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene is sourced from PubChem (CID 139077239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).