C20H20FeO2 — CID 131700222
[(1E)-2-(3,5-Dimethoxyphenyl)ethenyl]-ferrocene (PubChem CID 131700222) has the molecular formula C20H20FeO2 and a molecular weight of 348.22 g/mol.
| Compound Name | [(1E)-2-(3,5-Dimethoxyphenyl)ethenyl]-ferrocene |
|---|---|
| PubChem CID | 131700222 |
| Molecular Formula | C20H20FeO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | — |
| SMILES | COc1cc(/C=C/[C]2[CH][CH][CH][CH]2)cc(OC)c1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C15H15O2.C5H5.Fe/c1-16-14-9-13(10-15(11-14)17-2)8-7-12-5-3-4-6-12;1-2-4-5-3-1;/h3-11H,1-2H3;1-5H;/b8-7+;; |
| InChIKey | SJVQAYMPHYMMFR-MIIBGCIDSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|