C20H18O2 — CID 44563763
2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]naphthalene (PubChem CID 44563763) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]naphthalene.
| Compound Name | 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 44563763 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]naphthalene |
| SMILES | COc1cc(/C=C/c2ccc3ccccc3c2)cc(OC)c1 |
| InChI | InChI=1S/C20H18O2/c1-21-19-12-16(13-20(14-19)22-2)8-7-15-9-10-17-5-3-4-6-18(17)11-15/h3-14H,1-2H3/b8-7+ |
| InChIKey | BEWBEVSAYPCXOM-BQYQJAHWSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|