C42H34 — CID 134888133
2-[(Z)-2-[3-[3,5-bis[(Z)-prop-1-enyl]phenyl]-5-[(Z)-2-naphthalen-2-ylethenyl]phenyl]ethenyl]naphthalene (PubChem CID 134888133) has the molecular formula C42H34 and a molecular weight of 538.73 g/mol. Its IUPAC name is 2-[(Z)-2-[3-[3,5-bis[(Z)-prop-1-enyl]phenyl]-5-[(Z)-2-naphthalen-2-ylethenyl]phenyl]ethenyl]naphthalene.
| Compound Name | 2-[(Z)-2-[3-[3,5-bis[(Z)-prop-1-enyl]phenyl]-5-[(Z)-2-naphthalen-2-ylethenyl]phenyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 134888133 |
| Molecular Formula | C42H34 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-[(Z)-2-[3-[3,5-bis[(Z)-prop-1-enyl]phenyl]-5-[(Z)-2-naphthalen-2-ylethenyl]phenyl]ethenyl]naphthalene |
| SMILES | C/C=C\c1cc(/C=C\C)cc(-c2cc(/C=C\c3ccc4ccccc4c3)cc(/C=C\c3ccc4ccccc4c3)c2)c1 |
| InChI | InChI=1S/C42H34/c1-3-9-33-23-34(10-4-2)28-41(27-33)42-29-35(17-15-31-19-21-37-11-5-7-13-39(37)25-31)24-36(30-42)18-16-32-20-22-38-12-6-8-14-40(38)26-32/h3-30H,1-2H3/b9-3-,10-4-,17-15-,18-16- |
| InChIKey | JWWMVMNDJDNWNA-VQFBOQMZSA-N |
| XLogP | 12.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|