About 2-[(1E,3E)-penta-1,3-dienyl]naphthalene
2-[(1E,3E)-penta-1,3-dienyl]naphthalene (PubChem CID 135079977) has the molecular formula C15H14
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[(1E,3E)-penta-1,3-dienyl]naphthalene.
Molecular Properties
| Compound Name | 2-[(1E,3E)-penta-1,3-dienyl]naphthalene |
| PubChem CID | 135079977 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(1E,3E)-penta-1,3-dienyl]naphthalene |
| SMILES | C/C=C/C=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13/h2-12H,1H3/b3-2+,7-4+ |
| InChIKey | OUEHNYCIKHFCLP-AOGGBPEJSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3E)-penta-1,3-dienyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]naphthalene?
The IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]naphthalene (CID 135079977) is 2-[(1E,3E)-penta-1,3-dienyl]naphthalene.
What is the SMILES notation for 2-[(1E,3E)-penta-1,3-dienyl]naphthalene?
The canonical SMILES for 2-[(1E,3E)-penta-1,3-dienyl]naphthalene is C/C=C/C=C/c1ccc2ccccc2c1.
What is the InChIKey of 2-[(1E,3E)-penta-1,3-dienyl]naphthalene?
The InChIKey is OUEHNYCIKHFCLP-AOGGBPEJSA-N. The full InChI is InChI=1S/C15H14/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13/h2-12H,1H3/b3-2+,7-4+.
What are the key properties of 2-[(1E,3E)-penta-1,3-dienyl]naphthalene?
2-[(1E,3E)-penta-1,3-dienyl]naphthalene has a molecular weight of 194.28 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3E)-penta-1,3-dienyl]naphthalene is sourced from PubChem (CID 135079977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).