C15H14 — CID 135079977
2-[(1E,3E)-penta-1,3-dienyl]naphthalene (PubChem CID 135079977) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[(1E,3E)-penta-1,3-dienyl]naphthalene.
| Compound Name | 2-[(1E,3E)-penta-1,3-dienyl]naphthalene |
|---|---|
| PubChem CID | 135079977 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(1E,3E)-penta-1,3-dienyl]naphthalene |
| SMILES | C/C=C/C=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13/h2-12H,1H3/b3-2+,7-4+ |
| InChIKey | OUEHNYCIKHFCLP-AOGGBPEJSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|