C22H18 — CID 2818391
2-(6-phenylhexa-1,3,5-trienyl)naphthalene (PubChem CID 2818391) has the molecular formula C22H18 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(6-phenylhexa-1,3,5-trienyl)naphthalene.
| Compound Name | 2-(6-phenylhexa-1,3,5-trienyl)naphthalene |
|---|---|
| PubChem CID | 2818391 |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(6-phenylhexa-1,3,5-trienyl)naphthalene |
| SMILES | C(=CC=Cc1ccc2ccccc2c1)C=Cc1ccccc1 |
| InChI | InChI=1S/C22H18/c1(4-10-19-11-6-3-7-12-19)2-5-13-20-16-17-21-14-8-9-15-22(21)18-20/h1-18H |
| InChIKey | FVHQIEVOPVGNMM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|