C18H20ClN — CID 22483401
N-[1-(2-chlorophenyl)ethyl]-1-(2,4,6-trimethylphenyl)methanimine (PubChem CID 22483401) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-1-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-1-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 22483401 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-1-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/C=N/C(C)c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H20ClN/c1-12-9-13(2)17(14(3)10-12)11-20-15(4)16-7-5-6-8-18(16)19/h5-11,15H,1-4H3/b20-11+ |
| InChIKey | AXRHNNWIUFRQGN-RGVLZGJSSA-N |
| XLogP | 5.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|