C21H17Cl2N — CID 22483294
N-[1-(2,4-dichlorophenyl)ethyl]-1-(2-phenylphenyl)methanimine (PubChem CID 22483294) has the molecular formula C21H17Cl2N and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-1-(2-phenylphenyl)methanimine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-1-(2-phenylphenyl)methanimine |
|---|---|
| PubChem CID | 22483294 |
| Molecular Formula | C21H17Cl2N |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-1-(2-phenylphenyl)methanimine |
| SMILES | CC(/N=C/c1ccccc1-c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl2N/c1-15(19-12-11-18(22)13-21(19)23)24-14-17-9-5-6-10-20(17)16-7-3-2-4-8-16/h2-15H,1H3/b24-14+ |
| InChIKey | GMEMRFPCPFKFQQ-ZVHZXABRSA-N |
| XLogP | 6.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|