C9H12Cl2N4 — CID 64869015
1-amino-2-[1-(2,4-dichlorophenyl)ethyl]guanidine (PubChem CID 64869015) has the molecular formula C9H12Cl2N4 and a molecular weight of 247.13 g/mol. Its IUPAC name is 1-amino-2-[1-(2,4-dichlorophenyl)ethyl]guanidine.
| Compound Name | 1-amino-2-[1-(2,4-dichlorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 64869015 |
| Molecular Formula | C9H12Cl2N4 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-amino-2-[1-(2,4-dichlorophenyl)ethyl]guanidine |
| SMILES | CC(/N=C(\N)NN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N4/c1-5(14-9(12)15-13)7-3-2-6(10)4-8(7)11/h2-5H,13H2,1H3,(H3,12,14,15) |
| InChIKey | WTIALLDQXMXXEP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|