C9H12Cl2IN3 — CID 110884485
2-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 110884485) has the molecular formula C9H12Cl2IN3 and a molecular weight of 360.03 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110884485 |
| Molecular Formula | C9H12Cl2IN3 |
| Molecular Weight | 360.03 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N=C(N)N)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C9H11Cl2N3.HI/c1-5(14-9(12)13)7-3-2-6(10)4-8(7)11;/h2-5H,1H3,(H4,12,13,14);1H |
| InChIKey | SAACDJJOVSYVRX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.03 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|